Chemindex > 102-38-5
KR ▼
3-Nitroformanilide |
|
| 상품명칭 | 3-Nitroformanilide |
| 영문 이름 | 3-Nitroformanilide;N-(3-nitrophenyl)formamide |
| 분자식 | C7H6N2O3 |
| 분자량 | 166.1341 |
| InChI | InChI=1/C7H6N2O3/c10-5-8-6-2-1-3-7(4-6)9(11)12/h1-5H,(H,8,10) |
| cas번호 | 102-38-5 |
| 분자 구조 |  |
| 밀도 | 1.407g/cm3 |
| 비등점 | 368.5°C at 760 mmHg |
| 굴절 지수 | 1.641 |
| 인화점 | 176.7°C |
| 증기압 | 1.27E-05mmHg at 25°C |
| 리스크 규칙 | R20/22##Harmful by inhalation and if swallowed.:; |
| 보안 규칙 | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
| MSDS | |
- 중국에서 화학 물질을 공급할 계획이라면 ChemNet 쇼핑몰로 이동하면 중국 제조업체로부터 최신의 경쟁력있는 가격을 얻을 수 있습니다.방문하십시오
ChemNet Mall
Chemical CAS Database Service는 ChemIndex.com 에서 제공합니다. 