ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
101-99-5 N-Phenylurethane |
|
상품명칭 | N-Phenylurethane |
영문 이름 | N-Phenylurethane;Ethyl carbanilate~Ethyl N-phenylcarbamate;ethyl phenylcarbamate |
분자식 | C9H11NO2 |
분자량 | 165.1891 |
InChI | InChI=1/C9H11NO2/c1-2-12-9(11)10-8-6-4-3-5-7-8/h3-7H,2H2,1H3,(H,10,11) |
cas번호 | 101-99-5 |
EC번호 | 202-995-9 |
분자 구조 | ![]() |
밀도 | 1.136g/cm3 |
비등점 | 238°C at 760 mmHg |
굴절 지수 | 1.558 |
인화점 | 79.2°C |
증기압 | 0.0434mmHg at 25°C |
리스크 규칙 | R40##Possible risks of irreversible effects.:; |
보안 규칙 | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |