Chemindex > 101-17-7
KR ▼
101-17-7 3-Chlorodiphenylamine |
|
| 상품명칭 | 3-Chlorodiphenylamine |
| 영문 이름 | 3-Chlorodiphenylamine;Benzenamine, 3-chloro-N-phenyl-;3-chloro-N-phenylaniline;3-Chloro-N-phenyl-benzenamine;N-(3-chlorophenyl)aniline |
| 분자식 | C12H10ClN |
| 분자량 | 203.6675 |
| InChI | InChI=1/C12H10ClN/c13-10-5-4-8-12(9-10)14-11-6-2-1-3-7-11/h1-9,14H |
| cas번호 | 101-17-7 |
| EC번호 | 202-922-0 |
| 분자 구조 |  |
| 밀도 | 1.216g/cm3 |
| 비등점 | 337.8°C at 760 mmHg |
| 굴절 지수 | 1.642 |
| 인화점 | 147.4°C |
| 증기압 | 0.000102mmHg at 25°C |
| 리스크 규칙 | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
| 보안 규칙 | S28##After contact with skin, wash immediately with plenty of ...||S36/37##Wear suitable protective clothing and gloves.:; |
| MSDS | |
- 중국에서 화학 물질을 공급할 계획이라면 ChemNet 쇼핑몰로 이동하면 중국 제조업체로부터 최신의 경쟁력있는 가격을 얻을 수 있습니다.방문하십시오
ChemNet Mall
Chemical CAS Database Service는 ChemIndex.com 에서 제공합니다. 