ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
100-80-1 m-Vinyltoluene |
|
상품명칭 | m-Vinyltoluene |
영문 이름 | m-Vinyltoluene;3-Methylstyrene;3-Vinyltoluene |
분자식 | C9H10 |
분자량 | 118.17 |
InChI | InChI=1/C9H10/c1-3-9-6-4-5-8(2)7-9/h3-7H,1H2,2H3 |
cas번호 | 100-80-1 |
EC번호 | 202-889-2 |
분자 구조 | ![]() |
밀도 | 170 |
비등점 | 171℃ |
리스크 규칙 | R10##Flammable.||R20##Harmful by inhalation.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |