ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
99-21-8 N-(4-amino-5-methoxy-2-methylphenyl)benzamide |
|
Nome del prodotto | N-(4-amino-5-methoxy-2-methylphenyl)benzamide |
Nome inglese | N-(4-amino-5-methoxy-2-methylphenyl)benzamide;Benzamide, N-(4-amino-5-methoxy-2-methylphenyl)-;4'-Amino-5'-methoxy-2'-methylbenzanilide;4-amino-5-methoxy-2-methyl-N-phenylbenzamide;Fast Violet Base B;FAST VIOLER B BASE |
Formula molecolare | C15H16N2O2 |
Peso Molecolare | 256.2997 |
InChI | InChI=1/C15H16N2O2/c1-10-8-13(16)14(19-2)9-12(10)15(18)17-11-6-4-3-5-7-11/h3-9H,16H2,1-2H3,(H,17,18) |
Numero CAS | 99-21-8 |
EINECS | 202-740-1 |
Struttura molecolare | |
Densità | 1.215g/cm3 |
Punto di fusione | 185℃ |
Punto di ebollizione | 384.7°C at 760 mmHg |
Indice di rifrazione | 1.646 |
Punto d'infiammabilità | 186.5°C |
Pressione di vapore | 4.01E-06mmHg at 25°C |
Sicurezza Descrizione | S24/25##Avoid contact with skin and eyes.:; |
MSDS |