ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
95727-77-8 2,6-difluorobutirrofenone |
|
Nome del prodotto | 2,6-difluorobutirrofenone |
Sinonimi | 1-(2,6-difluorofenil)butan-1-one; |
Nome inglese | 2,6-Difluorobutyrophenone;1-(2,6-difluorophenyl)butan-1-one |
Formula molecolare | C10H10F2O |
Peso Molecolare | 184.1826 |
InChI | InChI=1/C10H10F2O/c1-2-4-9(13)10-7(11)5-3-6-8(10)12/h3,5-6H,2,4H2,1H3 |
Numero CAS | 95727-77-8 |
Struttura molecolare | |
Densità | 1.134g/cm3 |
Punto di ebollizione | 219.6°C at 760 mmHg |
Indice di rifrazione | 1.472 |
Punto d'infiammabilità | 82.6°C |
Pressione di vapore | 0.118mmHg at 25°C |
Codici di Rischio | R36/38##Irritating to eyes and skin.:; |
Sicurezza Descrizione | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |