ChemIndex - Un database CAS chimico gratuitoChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Pyronin Y |
|
Nome del prodotto | Pyronin Y |
Nome inglese | Pyronin Y;C.I. 45005;Pyronine;Pyronin G;PYRONINE G;pyronin Y molecular biology;Pyronin Y, CI 45005;Pyronine Y;N-[6-(dimethylamino)-3H-xanthen-3-ylidene]-N-methylmethanaminium chloride |
Formula molecolare | C17H19ClN2O |
Peso Molecolare | 302.7986 |
InChI | InChI=1/C17H19N2O.ClH/c1-18(2)14-7-5-12-9-13-6-8-15(19(3)4)11-17(13)20-16(12)10-14;/h5-11H,1-4H3;1H/q+1;/p-1 |
Numero CAS | 92-32-0 |
EINECS | 202-147-8 |
Struttura molecolare | |
Punto di fusione | 250-260℃ |
Simboli di pericolo | Xn##Harmful:; |
Sicurezza Descrizione | S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |