Chemindex > 88-97-1
IT ▼
phthalamic acid |
|
| Nome del prodotto | phthalamic acid |
| Nome inglese | phthalamic acid;Phthalamic acid, (2-Carboxybenzamide);2-Carboxybenzamide;2-carbamoylbenzoic acid |
| Formula molecolare | C8H7NO3 |
| Peso Molecolare | 165.1461 |
| InChI | InChI=1/C8H7NO3/c9-7(10)5-3-1-2-4-6(5)8(11)12/h1-4H,(H2,9,10)(H,11,12) |
| Numero CAS | 88-97-1 |
| EINECS | 201-871-1 |
| Struttura molecolare |  |
| Densità | 1.368g/cm3 |
| Punto di ebollizione | 394.2°C at 760 mmHg |
| Indice di rifrazione | 1.615 |
| Punto d'infiammabilità | 192.2°C |
| Pressione di vapore | 6.38E-07mmHg at 25°C |
| Codici di Rischio | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Sicurezza Descrizione | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |
- Se hai intenzione di procurarti prodotti chimici dalla Cina, vai al centro commerciale ChemNet, otterremo per te il prezzo più recente e competitivo dai produttori cinesi.Si prega di visitare
ChemNet Mall
Fornitori per 88-97-1 (0):
Il servizio di database CAS chimico è fornito da ChemIndex.com 