ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
85-29-0 2,4'-Dichlorobenzophenone |
|
Nome del prodotto | 2,4'-Dichlorobenzophenone |
Nome inglese | 2,4'-Dichlorobenzophenone;Dichlorobenzophenone |
Formula molecolare | C13H8Cl2O |
Peso Molecolare | 251.11 |
InChI | InChI=1/C13H8Cl2O/c14-10-7-5-9(6-8-10)13(16)11-3-1-2-4-12(11)15/h1-8H |
Numero CAS | 85-29-0 |
EINECS | 201-596-7 |
Struttura molecolare | |
Codici di Rischio | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Sicurezza Descrizione | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |