ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
823-76-7 Cyclohexyl methyl ketone |
|
Nome del prodotto | Cyclohexyl methyl ketone |
Nome inglese | Cyclohexyl methyl ketone;Acetylcyclohexane~Hexahydroacetophenone~Methyl cyclohexyl ketone;Acetylcyclohexane;1-cyclohexylethanone;1-CYCLOHEXYLETHAN-1-ONE |
Formula molecolare | C8H14O |
Peso Molecolare | 126.1962 |
InChI | InChI=1/C8H14O/c1-7(9)8-5-3-2-4-6-8/h8H,2-6H2,1H3 |
Numero CAS | 823-76-7 |
EINECS | 212-517-0 |
Struttura molecolare | ![]() |
Densità | 0.916g/cm3 |
Punto di ebollizione | 181.5°C at 760 mmHg |
Indice di rifrazione | 1.448 |
Punto d'infiammabilità | 61.4°C |
Pressione di vapore | 0.849mmHg at 25°C |
Codici di Rischio | R36/38##Irritating to eyes and skin.:; |
Sicurezza Descrizione | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |