ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
818-38-2 diethyl glutarate |
|
Nome del prodotto | diethyl glutarate |
Nome inglese | diethyl glutarate;Diethyl glutarate, (Glutaric acid diethyl ester);Glutaric acid diethyl ester;Diethyl Pentanediate;diethyl pentanedioate |
Formula molecolare | C9H16O4 |
Peso Molecolare | 188.2209 |
InChI | InChI=1/C9H16O4/c1-3-12-8(10)6-5-7-9(11)13-4-2/h3-7H2,1-2H3 |
Numero CAS | 818-38-2 |
EINECS | 212-451-2 |
Struttura molecolare | |
Densità | 1.022g/cm3 |
Punto di ebollizione | 236.5°C at 760 mmHg |
Indice di rifrazione | 1.427 |
Punto d'infiammabilità | 96.1°C |
Pressione di vapore | 0.0472mmHg at 25°C |
Sicurezza Descrizione | S24/25##Avoid contact with skin and eyes.:; |
MSDS |