ChemIndex - Un database CAS chimico gratuitoChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
N-bromoacetamide |
|
Nome del prodotto | N-bromoacetamide |
Nome inglese | N-bromoacetamide;N-Bromoacetamide;CCRIS 4590;Acetamide, N-bromo- |
Formula molecolare | C2H4BrNO |
Peso Molecolare | 137.9633 |
InChI | InChI=1/C2H4BrNO/c1-2(5)4-3/h1H3,(H,4,5) |
Numero CAS | 79-15-2 |
EINECS | 201-181-0 |
Struttura molecolare | |
Densità | 1.71g/cm3 |
Indice di rifrazione | 1.474 |
Codici di Rischio | R34##Causes burns.:; |
Sicurezza Descrizione | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |