ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
76649-14-4 3-Octen-2-ol |
|
Nome del prodotto | 3-Octen-2-ol |
Nome inglese | 3-Octen-2-ol;FEMA No. 3602;oct-3-en-2-ol;(3E)-oct-3-en-2-ol |
Formula molecolare | C8H16O |
Peso Molecolare | 128.212 |
InChI | InChI=1/C8H16O/c1-3-4-5-6-7-8(2)9/h6-9H,3-5H2,1-2H3/b7-6+ |
Numero CAS | 76649-14-4 |
EINECS | 278-508-9 |
Struttura molecolare | |
Densità | 0.843g/cm3 |
Punto di ebollizione | 178.8°C at 760 mmHg |
Indice di rifrazione | 1.447 |
Punto d'infiammabilità | 63.4°C |
Pressione di vapore | 0.291mmHg at 25°C |
Codici di Rischio | R36/38##Irritating to eyes and skin.:; |
Sicurezza Descrizione | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |