ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
700-35-6 2-chloro-4-fluoroacetophenone |
|
Nome del prodotto | 2-chloro-4-fluoroacetophenone |
Nome inglese | 2-chloro-4-fluoroacetophenone;2'-chloro-4'-fluoroacetophenone;1-(2-chloro-4-fluoro-phenyl)ethanone |
Formula molecolare | C8H6ClFO |
Peso Molecolare | 172.584 |
InChI | InChI=1/C8H6ClFO/c1-5(11)7-3-2-6(10)4-8(7)9/h2-4H,1H3 |
Numero CAS | 700-35-6 |
Struttura molecolare | ![]() |
Densità | 1.259g/cm3 |
Punto di ebollizione | 203.4°C at 760 mmHg |
Indice di rifrazione | 1.512 |
Punto d'infiammabilità | 76.814°C |
Pressione di vapore | 0.278mmHg at 25°C |
Codici di Rischio | R22##Harmful if swallowed.||R36/38##Irritating to eyes and skin.:; |
Sicurezza Descrizione | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |