ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
636-70-4 Triethylamine hydrobromide |
|
Nome del prodotto | Triethylamine hydrobromide |
Nome inglese | Triethylamine hydrobromide;triethylammonium bromide |
Formula molecolare | C6H15N.HBr |
Peso Molecolare | 182.10 |
InChI | InChI=1/C6H15N.BrH/c1-4-7(5-2)6-3;/h4-6H2,1-3H3;1H |
Numero CAS | 636-70-4 |
EINECS | 211-263-8 |
Struttura molecolare | |
Punto di fusione | 246-248℃ |
Simboli di pericolo | Xi##Irritant:; |
Codici di Rischio | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Sicurezza Descrizione | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |