ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
617-02-7 o-Tolyl benzoate |
|
Nome del prodotto | o-Tolyl benzoate |
Nome inglese | o-Tolyl benzoate;o-Tolyl benzoate (Benzoic acid o-tolyl ester);Benzoic acid o-tolyl ester;2-methylphenyl benzoate |
Formula molecolare | C14H12O2 |
Peso Molecolare | 212.2439 |
InChI | InChI=1/C14H12O2/c1-11-7-5-6-10-13(11)16-14(15)12-8-3-2-4-9-12/h2-10H,1H3 |
Numero CAS | 617-02-7 |
EINECS | 210-501-8 |
Struttura molecolare | |
Densità | 1.122g/cm3 |
Punto di ebollizione | 368.9°C at 760 mmHg |
Indice di rifrazione | 1.577 |
Punto d'infiammabilità | 154.5°C |
Pressione di vapore | 1.23E-05mmHg at 25°C |
Sicurezza Descrizione | S24/25##Avoid contact with skin and eyes.:; |
MSDS |