Chemindex > 609-11-0
IT ▼
Ethyl 2,3-dibromobutyrate |
|
| Nome del prodotto | Ethyl 2,3-dibromobutyrate |
| Nome inglese | Ethyl 2,3-dibromobutyrate;2,3-Dibromobutyric acid ethyl ester;2,3-Dibromo-n-butyric acid ethyl ester;ethyl 2,3-dibromobutanoate |
| Formula molecolare | C6H10Br2O2 |
| Peso Molecolare | 273.9504 |
| InChI | InChI=1/C6H10Br2O2/c1-3-10-6(9)5(8)4(2)7/h4-5H,3H2,1-2H3 |
| Numero CAS | 609-11-0 |
| EINECS | 210-177-8 |
| Struttura molecolare |  |
| Densità | 1.731g/cm3 |
| Punto di ebollizione | 226.7°C at 760 mmHg |
| Indice di rifrazione | 1.506 |
| Punto d'infiammabilità | 90.9°C |
| Pressione di vapore | 0.0809mmHg at 25°C |
| Codici di Rischio | R34##Causes burns.:; |
| Sicurezza Descrizione | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |
- Se hai intenzione di procurarti prodotti chimici dalla Cina, vai al centro commerciale ChemNet, otterremo per te il prezzo più recente e competitivo dai produttori cinesi.Si prega di visitare
ChemNet Mall
Fornitori per 609-11-0 (0):
Il servizio di database CAS chimico è fornito da ChemIndex.com 