ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
603-51-0 4,4-Diphenylsemicarbazide |
|
Nome del prodotto | 4,4-Diphenylsemicarbazide |
Nome inglese | 4,4-Diphenylsemicarbazide;Hydrazinecarboxamide, N,N-diphenyl-;AI3-52365;NSC 47698;NSC 8717;Semicarbazide, 4,4-diphenyl- (8CI);N,N-diphenylhydrazinecarboxamide |
Formula molecolare | C13H13N3O |
Peso Molecolare | 227.2618 |
InChI | InChI=1/C13H13N3O/c14-15-13(17)16(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H,14H2,(H,15,17) |
Numero CAS | 603-51-0 |
EINECS | 210-046-5 |
Struttura molecolare | |
Densità | 1.237g/cm3 |
Punto di fusione | 147-151℃ |
Indice di rifrazione | 1.656 |
Sicurezza Descrizione | S24/25##Avoid contact with skin and eyes.:; |
MSDS |