ChemIndex - Un database CAS chimico gratuitoChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2-Fluoro-5-Iodotoluene |
|
Nome del prodotto | 2-Fluoro-5-Iodotoluene |
Nome inglese | 2-Fluoro-5-Iodotoluene; |
Formula molecolare | C7H6FI |
Peso Molecolare | 236.02 |
InChI | InChI=1/C7H6FI/c1-5-4-6(9)2-3-7(5)8/h2-4H,1H3 |
Numero CAS | 452-68-6 |
EINECS | 207-206-1 |
Struttura molecolare | |
Codici di Rischio | R36/38##Irritating to eyes and skin.:; |
Sicurezza Descrizione | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |