ChemIndex - Un database CAS chimico gratuitoChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
3-fluorobenzal chloride |
|
Nome del prodotto | 3-fluorobenzal chloride |
Nome inglese | 3-fluorobenzal chloride;alpha,alpha-Dichloro-3-fluorotoluene |
Formula molecolare | C7H5Cl2F |
Peso Molecolare | 179.02 |
InChI | InChI=1/C7H5Cl2F/c8-7(9)5-2-1-3-6(10)4-5/h1-4,7H |
Numero CAS | 402-64-2 |
EINECS | 206-952-5 |
Struttura molecolare | |
Punto di ebollizione | 195℃ |
Codici di Rischio | R34##Causes burns.||R36##Irritating to eyes.:; |
Sicurezza Descrizione | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |