ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
36919-03-6 Methyl pentafluorophenyl carbonate |
|
Nome del prodotto | Methyl pentafluorophenyl carbonate |
Nome inglese | Methyl pentafluorophenyl carbonate;Pentafluorophenyl methyl carbonate |
Formula molecolare | C8H3F5O3 |
Peso Molecolare | 242.0996 |
InChI | InChI=1/C8H3F5O3/c1-15-8(14)16-7-5(12)3(10)2(9)4(11)6(7)13/h1H3 |
Numero CAS | 36919-03-6 |
Struttura molecolare | |
Densità | 1.567g/cm3 |
Punto di ebollizione | 207.5°C at 760 mmHg |
Indice di rifrazione | 1.422 |
Punto d'infiammabilità | 77.3°C |
Pressione di vapore | 0.224mmHg at 25°C |
Codici di Rischio | R22##Harmful if swallowed.||R36/38##Irritating to eyes and skin.:; |
Sicurezza Descrizione | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |