ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
347-63-7 3-(3-Fluoro-4-methoxybenzoyl)propionic acid |
|
Nome del prodotto | 3-(3-Fluoro-4-methoxybenzoyl)propionic acid |
Nome inglese | 3-(3-Fluoro-4-methoxybenzoyl)propionic acid; |
Formula molecolare | C11H11FO4 |
Peso Molecolare | 226.20 |
InChI | InChI=1/C11H11FO4/c1-16-10-4-2-7(6-8(10)12)9(13)3-5-11(14)15/h2,4,6H,3,5H2,1H3,(H,14,15) |
Numero CAS | 347-63-7 |
EINECS | 206-474-7 |
Struttura molecolare | |
Codici di Rischio | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Sicurezza Descrizione | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |