ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
34231-78-2 Acetoxybenzaldehyde; 97% |
|
Nome del prodotto | Acetoxybenzaldehyde; 97% |
Nome inglese | Acetoxybenzaldehyde; 97%;3-Acetoxybenzaldehyde;3-Formylphenyl acetate |
Formula molecolare | C9H8O3 |
Peso Molecolare | 164.158 |
InChI | InChI=1/C9H8O3/c1-7(11)12-9-4-2-3-8(5-9)6-10/h2-6H,1H3 |
Numero CAS | 34231-78-2 |
EINECS | 251-890-4 |
Struttura molecolare | |
Densità | 1.183g/cm3 |
Punto di ebollizione | 271.6°C at 760 mmHg |
Indice di rifrazione | 1.552 |
Punto d'infiammabilità | 117.6°C |
Pressione di vapore | 0.00637mmHg at 25°C |
Codici di Rischio | R36/38##Irritating to eyes and skin.:; |
Sicurezza Descrizione | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |