ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
332121-92-3 2-(Fmoc-amino)-4-chlorobenzoic acid |
|
Nome del prodotto | 2-(Fmoc-amino)-4-chlorobenzoic acid |
Nome inglese | 2-(Fmoc-amino)-4-chlorobenzoic acid;N-(9-Fluorenylmethoxycarbonyl)-4-chloroanthranilic acid~N-Fmoc-4-chloroanthranilic acid;4-chloro-2-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}benzoic acid |
Formula molecolare | C22H16ClNO4 |
Peso Molecolare | 393.8197 |
InChI | InChI=1/C22H16ClNO4/c23-13-9-10-18(21(25)26)20(11-13)24-22(27)28-12-19-16-7-3-1-5-14(16)15-6-2-4-8-17(15)19/h1-11,19H,12H2,(H,24,27)(H,25,26) |
Numero CAS | 332121-92-3 |
Struttura molecolare | ![]() |
Densità | 1.418g/cm3 |
Punto di ebollizione | 555.5°C at 760 mmHg |
Indice di rifrazione | 1.687 |
Punto d'infiammabilità | 289.8°C |
Pressione di vapore | 3.54E-13mmHg at 25°C |
Codici di Rischio | R36/38##Irritating to eyes and skin.:; |
Sicurezza Descrizione | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |