ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
304-91-6 2-iodosobenzoic acid moistened with water (H2O ~10%) |
|
Nome del prodotto | 2-iodosobenzoic acid moistened with water (H2O ~10%) |
Nome inglese | 2-iodosobenzoic acid moistened with water (H2O ~10%);o-Iodosobenzoic acid 2-Iodosobenzoic acid;Iodosobenzoicacid;2-iodosylbenzoic acid |
Formula molecolare | C7H5IO3 |
Peso Molecolare | 264.0173 |
InChI | InChI=1/C7H5IO3/c9-7(10)5-3-1-2-4-6(5)8-11/h1-4H,(H,9,10) |
Numero CAS | 304-91-6 |
EINECS | 206-159-4 |
Struttura molecolare | |
Punto di fusione | 230℃ (dec.) |
Simboli di pericolo | Xi##Irritant:; |
Codici di Rischio | R36/37/38:; |
Sicurezza Descrizione | S26||S36:; |
MSDS |