Chemindex > 18781-31-2
IT ▼
18781-31-2 2-Acetyl-3-methylbenzo[b]thiophene |
|
| Nome del prodotto | 2-Acetyl-3-methylbenzo[b]thiophene |
| Nome inglese | 2-Acetyl-3-methylbenzo[b]thiophene;2-Acetyl-3-methylthianaphthene;1-(3-Methylbenzo[b]thiophen-2-yl)ethan-1-one;1-(3-methyl-1-benzothiophen-6-yl)ethanone;1-(3-methyl-1-benzothiophen-2-yl)ethanone |
| Formula molecolare | C11H10OS |
| Peso Molecolare | 190.2615 |
| InChI | InChI=1/C11H10OS/c1-7-9-5-3-4-6-10(9)13-11(7)8(2)12/h3-6H,1-2H3 |
| Numero CAS | 18781-31-2 |
| Struttura molecolare | ![18781-31-2 2-Acetyl-3-methylbenzo[b]thiophene](https://images-a.chemnet.com/suppliers/chembase/cas3/cas18781-31-2.gif "18781-31-2 2-Acetyl-3-methylbenzo[b]thiophene") |
| Densità | 1.182g/cm3 |
| Punto di fusione | 79℃ |
| Punto di ebollizione | 319.5°C at 760 mmHg |
| Indice di rifrazione | 1.631 |
| Punto d'infiammabilità | 147°C |
| Pressione di vapore | 0.000337mmHg at 25°C |
| Sicurezza Descrizione | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |
- Se hai intenzione di procurarti prodotti chimici dalla Cina, vai al centro commerciale ChemNet, otterremo per te il prezzo più recente e competitivo dai produttori cinesi.Si prega di visitare
ChemNet Mall
Il servizio di database CAS chimico è fornito da ChemIndex.com 