ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
112-79-8 Elaidic acid |
|
Nome del prodotto | Elaidic acid |
Nome inglese | Elaidic acid;trans-9-Octadecenoic acid~trans-Oleic acid;trans-9-Octadecenic acid;(9E)-octadec-9-enoic acid |
Formula molecolare | C18H34O2 |
Peso Molecolare | 282.4614 |
InChI | InChI=1/C18H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h9-10H,2-8,11-17H2,1H3,(H,19,20)/b10-9+ |
Numero CAS | 112-79-8 |
EINECS | 204-006-6 |
Struttura molecolare | |
Densità | 0.899g/cm3 |
Punto di fusione | 43-45℃ |
Punto di ebollizione | 360°C at 760 mmHg |
Indice di rifrazione | 1.466 |
Punto d'infiammabilità | 270.1°C |
Pressione di vapore | 3.7E-06mmHg at 25°C |
Sicurezza Descrizione | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |