ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
111-80-8 Methyl 2-nonynoate |
|
Nome del prodotto | Methyl 2-nonynoate |
Nome inglese | Methyl 2-nonynoate;2-Nonynoic acid methyl ester;2-Nonynoic acid, methyl ester;Methyl octin carbonate;Methyl octine carbonate;Octynecarboxylic acid, methyl ester;methyl non-2-ynoate |
Formula molecolare | C10H16O2 |
Peso Molecolare | 168.2328 |
InChI | InChI=1/C10H16O2/c1-3-4-5-6-7-8-9-10(11)12-2/h3-7H2,1-2H3 |
Numero CAS | 111-80-8 |
EINECS | 203-909-2 |
Struttura molecolare | |
Densità | 0.932g/cm3 |
Punto di ebollizione | 233.1°C at 760 mmHg |
Indice di rifrazione | 1.446 |
Punto d'infiammabilità | 100.6°C |
Pressione di vapore | 0.0568mmHg at 25°C |
Simboli di pericolo | Xi##Irritant:; |
Codici di Rischio | R36/38##Irritating to eyes and skin.:; |
Sicurezza Descrizione | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |