ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
110-36-1 butyl myristate |
|
Nome del prodotto | butyl myristate |
Nome inglese | butyl myristate;n-Butyl myristate~Myristic acid n-butyl ester~Teradecanoic acid n-butyl ester;Myristicacidnbutylester;Myristic acid n-butyl ester;butyl tetradecanoate |
Formula molecolare | C18H36O2 |
Peso Molecolare | 284.4772 |
InChI | InChI=1/C18H36O2/c1-3-5-7-8-9-10-11-12-13-14-15-16-18(19)20-17-6-4-2/h3-17H2,1-2H3 |
Numero CAS | 110-36-1 |
EINECS | 203-759-8 |
Struttura molecolare | ![]() |
Densità | 0.864g/cm3 |
Punto di ebollizione | 334.7°C at 760 mmHg |
Indice di rifrazione | 1.442 |
Punto d'infiammabilità | 158.5°C |
Pressione di vapore | 0.000126mmHg at 25°C |
Codici di Rischio | R36/38##Irritating to eyes and skin.:; |
Sicurezza Descrizione | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |