ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
104-46-1 Anethole |
|
Nome del prodotto | Anethole |
Nome inglese | Anethole;Anise camphor;1-(p-methoxyphenyl)propene;1-methoxy-4-(1-propenyl)benzene;1-methoxy-4-propenylbenzene;p-1-propenylanisole;p-methoxy-beta-methylstyrene;p-propenylphenyl methyl ether;isoestragole;Methoxy-4-propenylbenzene;nauli ''gum'';oil of aniseed;Propenylanisole;1-methoxy-4-[(1E)-prop-1-en-1-yl]benzene;1-methoxy-4-[(1Z)-prop-1-en-1-yl]benzene;Anethol |
Formula molecolare | C10H12O |
Peso Molecolare | 148.2017 |
InChI | InChI=1/C10H12O/c1-3-10(11-2)9-7-5-4-6-8-9/h3-8H,1-2H3 |
Numero CAS | 104-46-1 |
EINECS | 203-205-5 |
Struttura molecolare | |
Punto di fusione | 23-22℃ |
Indice di rifrazione | 1.514 |
Sicurezza Descrizione | S24/25##Avoid contact with skin and eyes.:; |
MSDS |