ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
103-43-5 dibenzyl succinate |
|
Nome del prodotto | dibenzyl succinate |
Nome inglese | dibenzyl succinate;Dibenzyl succinate, (Succinic acid dibenzyl ester);Succinic acid dibenzyl ester;Butanedioic acid dibenzyl ester~Succinic acid dibenzyl ester;dibenzyl butanedioate |
Formula molecolare | C18H18O4 |
Peso Molecolare | 298.3331 |
InChI | InChI=1/C18H18O4/c19-17(21-13-15-7-3-1-4-8-15)11-12-18(20)22-14-16-9-5-2-6-10-16/h1-10H,11-14H2 |
Numero CAS | 103-43-5 |
EINECS | 203-110-9 |
Struttura molecolare | ![]() |
Densità | 1.165g/cm3 |
Punto di ebollizione | 416.4°C at 760 mmHg |
Indice di rifrazione | 1.556 |
Punto d'infiammabilità | 205.7°C |
Pressione di vapore | 3.82E-07mmHg at 25°C |
Sicurezza Descrizione | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |