ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
102-38-5 3-Nitroformanilide |
|
Nome del prodotto | 3-Nitroformanilide |
Nome inglese | 3-Nitroformanilide;N-(3-nitrophenyl)formamide |
Formula molecolare | C7H6N2O3 |
Peso Molecolare | 166.1341 |
InChI | InChI=1/C7H6N2O3/c10-5-8-6-2-1-3-7(4-6)9(11)12/h1-5H,(H,8,10) |
Numero CAS | 102-38-5 |
Struttura molecolare | |
Densità | 1.407g/cm3 |
Punto di ebollizione | 368.5°C at 760 mmHg |
Indice di rifrazione | 1.641 |
Punto d'infiammabilità | 176.7°C |
Pressione di vapore | 1.27E-05mmHg at 25°C |
Codici di Rischio | R20/22##Harmful by inhalation and if swallowed.:; |
Sicurezza Descrizione | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |