ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
99-42-3 Methyl 4-hydroxy-3-nitrobenzoate |
|
نام محصول | Methyl 4-hydroxy-3-nitrobenzoate |
نام انگلیسی | Methyl 4-hydroxy-3-nitrobenzoate;4-Hydroxy-3-nitrobenzoic acid methyl ester;Methyl 3-nitro-4-hydroxybenzoate;4-(methoxycarbonyl)-2-nitrophenolate;3-nitro-4-hydroxymethyl benzoate |
میدان مغناطیسی | C8H6NO5 |
وزن مولکولی | 196.1375 |
InChI | InChI=1/C8H7NO5/c1-14-8(11)5-2-3-7(10)6(4-5)9(12)13/h2-4,10H,1H3/p-1 |
شماره سیایاس | 99-42-3 |
تعداد کمیسیون اروپایی | 202-755-3 |
ساختار مولکولی | |
نقطه ذوب | 74-76℃ |
نقطه غلیان | 311.1°C at 760 mmHg |
نقطه اشتعال | 141.9°C |
فشار بخار | 0.000315mmHg at 25°C |
کدهای خطر | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |