ChemIndex - یک پایگاه داده CAS شیمیایی رایگانChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
N-(4-amino-5-methoxy-2-methylphenyl)benzamide |
|
نام محصول | N-(4-amino-5-methoxy-2-methylphenyl)benzamide |
نام انگلیسی | N-(4-amino-5-methoxy-2-methylphenyl)benzamide;Benzamide, N-(4-amino-5-methoxy-2-methylphenyl)-;4'-Amino-5'-methoxy-2'-methylbenzanilide;4-amino-5-methoxy-2-methyl-N-phenylbenzamide;Fast Violet Base B;FAST VIOLER B BASE |
میدان مغناطیسی | C15H16N2O2 |
وزن مولکولی | 256.2997 |
InChI | InChI=1/C15H16N2O2/c1-10-8-13(16)14(19-2)9-12(10)15(18)17-11-6-4-3-5-7-11/h3-9H,16H2,1-2H3,(H,17,18) |
شماره سیایاس | 99-21-8 |
تعداد کمیسیون اروپایی | 202-740-1 |
ساختار مولکولی | |
تراکم | 1.215g/cm3 |
نقطه ذوب | 185℃ |
نقطه غلیان | 384.7°C at 760 mmHg |
ضریب شکست | 1.646 |
نقطه اشتعال | 186.5°C |
فشار بخار | 4.01E-06mmHg at 25°C |
توضیحات ایمنی | S24/25##Avoid contact with skin and eyes.:; |
MSDS |