ChemIndex - یک پایگاه داده CAS شیمیایی رایگانChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
D-Trehalose anhydrous |
|
نام محصول | D-Trehalose anhydrous |
نام انگلیسی | D-Trehalose anhydrous;Trehalose;alpha-D-Trehalose;alpha-D-glucopyranosyl alpha-D-glucopyranoside;Trehalose;D(+)Trehalose;D-(+)-Trehalose;α-L-glucopyranosyl;α-D-glucopyranoside;Trehalose anhydrous |
میدان مغناطیسی | C12H22O11 |
وزن مولکولی | 342.2965 |
InChI | InChI=1/C12H22O11/c13-1-3-5(15)7(17)9(19)11(21-3)23-12-10(20)8(18)6(16)4(2-14)22-12/h3-20H,1-2H2/t3-,4-,5-,6-,7+,8+,9-,10-,11-,12-/m1/s1 |
شماره سیایاس | 99-20-7 |
تعداد کمیسیون اروپایی | 202-739-6 |
ساختار مولکولی | |
تراکم | 1.76g/cm3 |
نقطه ذوب | 214-216℃ |
نقطه غلیان | 675.4°C at 760 mmHg |
ضریب شکست | 1.652 |
نقطه اشتعال | 362.3°C |
فشار بخار | 3.87E-21mmHg at 25°C |
توضیحات ایمنی | S24/25##Avoid contact with skin and eyes.:; |
MSDS |