ChemIndex - یک پایگاه داده CAS شیمیایی رایگانChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
alpha-bromostyrene |
|
نام محصول | alpha-bromostyrene |
نام انگلیسی | alpha-bromostyrene;1-(1-Bromovinyl)benzene;(1-bromoethenyl)benzene |
میدان مغناطیسی | C8H7Br |
وزن مولکولی | 183.0452 |
InChI | InChI=1/C8H7Br/c1-7(9)8-5-3-2-4-6-8/h2-6H,1H2 |
شماره سیایاس | 98-81-7 |
تعداد کمیسیون اروپایی | 202-702-4 |
ساختار مولکولی | |
تراکم | 1.387g/cm3 |
نقطه ذوب | -44℃ |
نقطه غلیان | 212.6°C at 760 mmHg |
ضریب شکست | 1.574 |
نقطه اشتعال | 98.3°C |
فشار بخار | 0.249mmHg at 25°C |
خطر نمادها | Xi##Irritant:; |
کدهای خطر | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |