ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
94-96-2 2-Ethyl-1,3-hexanediol, mixture of isomers |
|
نام محصول | 2-Ethyl-1,3-hexanediol, mixture of isomers |
نام انگلیسی | 2-Ethyl-1,3-hexanediol, mixture of isomers;Ethohexadiol;2-Ethylhexane-1,3-diol;octylene glycol;2-ethylhexane-1,1-diol;(2S,3S)-2-ethylhexane-1,3-diol;(2R,3S)-2-ethylhexane-1,3-diol;(2R,3R)-2-ethylhexane-1,3-diol;(2S,3R)-2-ethylhexane-1,3-diol;OG;2-Ethyl-1,3-Hexanediol |
میدان مغناطیسی | C8H18O2 |
وزن مولکولی | 146.2273 |
InChI | InChI=1/C8H18O2/c1-3-5-8(10)7(4-2)6-9/h7-10H,3-6H2,1-2H3/t7-,8+/m0/s1 |
شماره سیایاس | 94-96-2 |
تعداد کمیسیون اروپایی | 202-377-9 |
ساختار مولکولی | |
تراکم | 0.935g/cm3 |
نقطه ذوب | -40℃ |
نقطه غلیان | 243°C at 760 mmHg |
ضریب شکست | 1.45 |
نقطه اشتعال | 129.4°C |
حلالیت آب | 42 g/L (20℃) |
فشار بخار | 0.00558mmHg at 25°C |
خطر نمادها | Xi##Irritant:; |
کدهای خطر | R41:; |
توضیحات ایمنی | S25||S26||S39||S46:; |
MSDS |