ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
93-16-3 Benzene, 1,2-dimethoxy-4-(1-propenyl)- |
|
نام محصول | Benzene, 1,2-dimethoxy-4-(1-propenyl)- |
نام انگلیسی | Benzene, 1,2-dimethoxy-4-(1-propenyl)-;1,2-Dimethoxy-4-propen-1-yl benzene; 3,4-Dimethoxy-1,1-propen-1-yl benzene; Isoeugenenyl methyl ether; Isoeugenol methyl ether; Isoeugenyl methyl ether; Methyl isoeugenol; ;1,2-dimethoxy-4-(prop-1-en-1-yl)benzene;2-methoxy-3-methyl-4-[(1E)-prop-1-en-1-yl]phenol;2-methoxy-4-[(1E)-prop-1-en-1-yl]phenol - methoxymethane (1:1);1,2-dimethoxy-4-[(Z)-prop-1-enyl]benzene |
میدان مغناطیسی | C11H14O2 |
وزن مولکولی | 178.2277 |
InChI | InChI=1/C11H14O2/c1-4-5-9-6-7-10(12-2)11(8-9)13-3/h4-8H,1-3H3/b5-4- |
شماره سیایاس | 93-16-3 |
تعداد کمیسیون اروپایی | 202-224-6 |
ساختار مولکولی | |
تراکم | 0.998g/cm3 |
نقطه ذوب | 62.6℃ |
نقطه غلیان | 271.1°C at 760 mmHg |
ضریب شکست | 1.534 |
نقطه اشتعال | 104.5°C |
فشار بخار | 0.011mmHg at 25°C |
کدهای خطر | R36/38##Irritating to eyes and skin.:; |
توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |