ChemIndex - یک پایگاه داده CAS شیمیایی رایگانChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
n-Propylthiourea |
|
نام محصول | n-Propylthiourea |
نام انگلیسی | n-Propylthiourea;Propyl-2-thiourea;Propylthiourea;Thiourea, propyl-;1-propylthiourea |
میدان مغناطیسی | C4H10N2S |
وزن مولکولی | 118.2006 |
InChI | InChI=1/C4H10N2S/c1-2-3-6-4(5)7/h2-3H2,1H3,(H3,5,6,7) |
شماره سیایاس | 927-67-3 |
تعداد کمیسیون اروپایی | 213-158-2 |
ساختار مولکولی | |
تراکم | 1.054g/cm3 |
نقطه غلیان | 182.1°C at 760 mmHg |
ضریب شکست | 1.537 |
نقطه اشتعال | 63.9°C |
فشار بخار | 0.825mmHg at 25°C |
کدهای خطر | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
توضیحات ایمنی | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |