ChemIndex - یک پایگاه داده CAS شیمیایی رایگانChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
DL-Bromosuccinic acid |
|
نام محصول | DL-Bromosuccinic acid |
نام انگلیسی | DL-Bromosuccinic acid;Bromobutanedioic acid;Bromosuccinic Acid;2-bromobutanedioic acid;(2R)-2-bromobutanedioate;(2S)-2-bromobutanedioate;2-Bromosuccinic acid |
میدان مغناطیسی | C4H3BrO4 |
وزن مولکولی | 194.9693 |
InChI | InChI=1/C4H5BrO4/c5-2(4(8)9)1-3(6)7/h2H,1H2,(H,6,7)(H,8,9)/p-2/t2-/m0/s1 |
شماره سیایاس | 923-06-8 |
تعداد کمیسیون اروپایی | 213-087-7 |
ساختار مولکولی | |
نقطه ذوب | 160-162℃ |
نقطه غلیان | 255.1°C at 760 mmHg |
نقطه اشتعال | 108.1°C |
فشار بخار | 0.00512mmHg at 25°C |
خطر نمادها | Xi##Irritant:; |
کدهای خطر | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |