ChemIndex - یک پایگاه داده CAS شیمیایی رایگانChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Lanthionine |
|
نام محصول | Lanthionine |
نام انگلیسی | Lanthionine;lanthionine, mixture of dl and meso;di(2-amino-2-carboxyethyl) sulphide;S-[(2R)-2-amino-2-carboxyethyl]-D-cysteine;S-[(2R)-2-amino-2-carboxyethyl]-L-cysteine;(2S,2'S)-3,3'-sulfanediylbis(2-ammoniopropanoate) |
میدان مغناطیسی | C6H12N2O4S |
وزن مولکولی | 208.2355 |
InChI | InChI=1/C6H12N2O4S/c7-3(5(9)10)1-13-2-4(8)6(11)12/h3-4H,1-2,7-8H2,(H,9,10)(H,11,12)/t3-,4-/m1/s1 |
شماره سیایاس | 922-55-4 |
تعداد کمیسیون اروپایی | 213-076-7 |
ساختار مولکولی | |
تراکم | 1.499g/cm3 |
نقطه ذوب | 280-283℃ |
نقطه غلیان | 462.6°C at 760 mmHg |
ضریب شکست | 1.606 |
نقطه اشتعال | 233.5°C |
فشار بخار | 7.72E-10mmHg at 25°C |
توضیحات ایمنی | S24/25##Avoid contact with skin and eyes.:; |
MSDS |