ChemIndex - یک پایگاه داده CAS شیمیایی رایگانChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2,3-Benzanthracene |
|
نام محصول | 2,3-Benzanthracene |
نام انگلیسی | 2,3-Benzanthracene;NAPHTHACENE;Chrysogen;LT-S940;Tetracene |
میدان مغناطیسی | C18H12 |
وزن مولکولی | 228.2879 |
InChI | InChI=1/C18H12/c1-2-6-14-10-18-12-16-8-4-3-7-15(16)11-17(18)9-13(14)5-1/h1-12H |
شماره سیایاس | 92-24-0 |
تعداد کمیسیون اروپایی | 202-138-9 |
ساختار مولکولی | |
تراکم | 1.19g/cm3 |
نقطه ذوب | 300℃ |
نقطه غلیان | 436.7°C at 760 mmHg |
ضریب شکست | 1.771 |
نقطه اشتعال | 209.1°C |
فشار بخار | 2.02E-07mmHg at 25°C |
خطر نمادها | Xn##Harmful:; |
کدهای خطر | R40##Possible risks of irreversible effects.:; |
توضیحات ایمنی | S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |