ChemIndex - یک پایگاه داده CAS شیمیایی رایگانChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
1-Chloro-2,5-diethoxy-4-nitrobenzene |
|
نام محصول | 1-Chloro-2,5-diethoxy-4-nitrobenzene |
نام انگلیسی | 1-Chloro-2,5-diethoxy-4-nitrobenzene;Benzene, 1-chloro-2,5-diethoxy-4-nitro-;2,5-Diethoxy-4-nitrochlorobenzene;5-Chloro-2-nitro-p-diethoxybenzene;NSC 60284 |
میدان مغناطیسی | C10H12ClNO4 |
وزن مولکولی | 245.6596 |
InChI | InChI=1/C10H12ClNO4/c1-3-15-9-6-8(12(13)14)10(16-4-2)5-7(9)11/h5-6H,3-4H2,1-2H3 |
شماره سیایاس | 91-43-0 |
تعداد کمیسیون اروپایی | 202-067-3 |
ساختار مولکولی | |
تراکم | 1.264g/cm3 |
نقطه غلیان | 368.4°C at 760 mmHg |
ضریب شکست | 1.533 |
نقطه اشتعال | 176.6°C |
فشار بخار | 2.7E-05mmHg at 25°C |
خطر نمادها | Xi##Irritant:; |
کدهای خطر | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |