ChemIndex - یک پایگاه داده CAS شیمیایی رایگانChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
ایزوپولگیل استات، مخلوط ایزومرها؛ |
|
نام محصول | ایزوپولگیل استات، مخلوط ایزومرها؛ |
مترادف | (1R، 2R، 5R) -5-متیل-2- (1-methylethenyl) سیکلوهگزیل استات؛ (1R، 2R، 5S) -5-متیل-2- (1-متیل اتنیل) سیکلوهگزیل استات؛ (1R، 2S، 5S) -5-متیل-2- (1-متیل اتنیل) سیکلوهگزیل استات؛ |
نام انگلیسی | Isopulegyl acetate, mixture of isomers;(1R,2R,5R)-5-methyl-2-(1-methylethenyl)cyclohexyl acetate;(1R,2R,5S)-5-methyl-2-(1-methylethenyl)cyclohexyl acetate;(1R,2S,5S)-5-methyl-2-(1-methylethenyl)cyclohexyl acetate |
میدان مغناطیسی | C12H20O2 |
وزن مولکولی | 196.286 |
InChI | InChI=1/C12H20O2/c1-8(2)11-6-5-9(3)7-12(11)14-10(4)13/h9,11-12H,1,5-7H2,2-4H3/t9-,11-,12+/m0/s1 |
شماره سیایاس | 89-49-6 |
ساختار مولکولی | |
تراکم | 0.94g/cm3 |
نقطه غلیان | 248°C at 760 mmHg |
ضریب شکست | 1.458 |
نقطه اشتعال | 85.6°C |
فشار بخار | 0.0248mmHg at 25°C |
توضیحات ایمنی | S24/25##Avoid contact with skin and eyes.:; |
MSDS |