ChemIndex - یک پایگاه داده CAS شیمیایی رایگانChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2-Chloro-6-methylphenol |
|
نام محصول | 2-Chloro-6-methylphenol |
نام انگلیسی | 2-Chloro-6-methylphenol;2-Chloro-6-methylphenol,98%;6-Chloro-o-cresol (OH=1);6-Chloro-o-cresol |
میدان مغناطیسی | C7H7ClO |
وزن مولکولی | 142.5829 |
InChI | InChI=1/C7H7ClO/c1-5-3-2-4-6(8)7(5)9/h2-4,9H,1H3 |
شماره سیایاس | 87-64-9 |
تعداد کمیسیون اروپایی | 201-760-8 |
ساختار مولکولی | |
تراکم | 1.228g/cm3 |
نقطه غلیان | 200.4°C at 760 mmHg |
ضریب شکست | 1.565 |
نقطه اشتعال | 75°C |
فشار بخار | 0.229mmHg at 25°C |
کدهای خطر | R21/22##Harmful in contact with skin and if swallowed.||R36/38##Irritating to eyes and skin.:; |
توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S28##After contact with skin, wash immediately with plenty of ...||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |