ChemIndex - یک پایگاه داده CAS شیمیایی رایگانChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
cinnamyl anthranilate |
|
نام محصول | cinnamyl anthranilate |
نام انگلیسی | cinnamyl anthranilate;2-Aminobenzoic acid cinnamyl ester~Cinnamyl anthranilate;3-phenylprop-2-en-1-yl 2-aminobenzoate;(2E)-3-phenylprop-2-en-1-yl 2-aminobenzoate |
میدان مغناطیسی | C16H15NO2 |
وزن مولکولی | 253.2958 |
InChI | InChI=1/C16H15NO2/c17-15-11-5-4-10-14(15)16(18)19-12-6-9-13-7-2-1-3-8-13/h1-11H,12,17H2/b9-6+ |
شماره سیایاس | 87-29-6 |
تعداد کمیسیون اروپایی | 201-738-8 |
ساختار مولکولی | |
تراکم | 1.178g/cm3 |
نقطه غلیان | 449.1°C at 760 mmHg |
ضریب شکست | 1.642 |
نقطه اشتعال | 269.4°C |
فشار بخار | 2.95E-08mmHg at 25°C |
توضیحات ایمنی | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |