ChemIndex - یک پایگاه داده CAS شیمیایی رایگانChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
5,6-Benzoquinoline |
|
نام محصول | 5,6-Benzoquinoline |
نام انگلیسی | 5,6-Benzoquinoline;beta-Naphthoquinoline;1-Azaphenanthrene;Benzo[f]quinoline;Benzoquinoline;benzo(f)quinoline |
میدان مغناطیسی | C13H9N |
وزن مولکولی | 179.2173 |
InChI | InChI=1/C13H9N/c1-2-5-11-10(4-1)7-8-13-12(11)6-3-9-14-13/h1-9H |
شماره سیایاس | 85-02-9 |
تعداد کمیسیون اروپایی | 201-582-0 |
ساختار مولکولی | |
تراکم | 1.187g/cm3 |
نقطه ذوب | 89-91℃ |
نقطه غلیان | 350.4°C at 760 mmHg |
ضریب شکست | 1.726 |
نقطه اشتعال | 155.9°C |
فشار بخار | 8.89E-05mmHg at 25°C |
خطر نمادها | Xn##Harmful:; |
کدهای خطر | R36/37/38##Irritating to eyes, respiratory system and skin.||R40##Possible risks of irreversible effects.:; |
توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |