ChemIndex - یک پایگاه داده CAS شیمیایی رایگانChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2,5-Dimethyl-1-phenylpyrrole |
|
نام محصول | 2,5-Dimethyl-1-phenylpyrrole |
نام انگلیسی | 2,5-Dimethyl-1-phenylpyrrole;1H-Pyrrole, 2,5-dimethyl-1-phenyl-;NSC 163170;2,5-Dimethyl-1-phenyl-1H-pyrrole;Pyrrole, 2,5-dimethyl-1-phenyl- (8CI);1-cyclohexyl-2,5-dimethyl-1H-pyrrole;2,5-dimethyl-1-phenylpyrrolidine |
میدان مغناطیسی | C12H17N |
وزن مولکولی | 175.2701 |
InChI | InChI=1/C12H17N/c1-10-8-9-11(2)13(10)12-6-4-3-5-7-12/h3-7,10-11H,8-9H2,1-2H3 |
شماره سیایاس | 83-24-9 |
تعداد کمیسیون اروپایی | 201-461-2 |
ساختار مولکولی | |
تراکم | 0.952g/cm3 |
نقطه ذوب | 50-51℃ |
نقطه غلیان | 257.7°C at 760 mmHg |
ضریب شکست | 1.519 |
نقطه اشتعال | 100.2°C |
فشار بخار | 0.0143mmHg at 25°C |
توضیحات ایمنی | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |