ChemIndex - یک پایگاه داده CAS شیمیایی رایگانChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2,5-Dimethyl-1-phenylpyrrole-3-carboxaldehyde |
|
نام محصول | 2,5-Dimethyl-1-phenylpyrrole-3-carboxaldehyde |
نام انگلیسی | 2,5-Dimethyl-1-phenylpyrrole-3-carboxaldehyde;1H-Pyrrole-3-carboxaldehyde, 2,5-dimethyl-1-phenyl-;NSC 68230;2,5-Dimethyl-1-phenyl-1H-pyrrole-3-carbaldehyde;Pyrrole-3-carboxaldehyde, 2,5-dimethyl-1-phenyl- (8CI);1-cyclohexyl-2,5-dimethyl-1H-pyrrole-3-carbaldehyde;2,5-dimethyl-1-phenylpyrrole-3-carbaldehyde |
میدان مغناطیسی | C13H19NO |
وزن مولکولی | 205.2961 |
InChI | InChI=1/C13H19NO/c1-10-8-12(9-15)11(2)14(10)13-6-4-3-5-7-13/h8-9,13H,3-7H2,1-2H3 |
شماره سیایاس | 83-18-1 |
تعداد کمیسیون اروپایی | 201-458-6 |
ساختار مولکولی | |
تراکم | 1.07g/cm3 |
نقطه غلیان | 345.8°C at 760 mmHg |
ضریب شکست | 1.559 |
نقطه اشتعال | 163°C |
فشار بخار | 6E-05mmHg at 25°C |
توضیحات ایمنی | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |