ChemIndex - یک پایگاه داده CAS شیمیایی رایگانChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Cyclohexyl methyl ketone |
|
نام محصول | Cyclohexyl methyl ketone |
نام انگلیسی | Cyclohexyl methyl ketone;Acetylcyclohexane~Hexahydroacetophenone~Methyl cyclohexyl ketone;Acetylcyclohexane;1-cyclohexylethanone;1-CYCLOHEXYLETHAN-1-ONE |
میدان مغناطیسی | C8H14O |
وزن مولکولی | 126.1962 |
InChI | InChI=1/C8H14O/c1-7(9)8-5-3-2-4-6-8/h8H,2-6H2,1H3 |
شماره سیایاس | 823-76-7 |
تعداد کمیسیون اروپایی | 212-517-0 |
ساختار مولکولی | |
تراکم | 0.916g/cm3 |
نقطه غلیان | 181.5°C at 760 mmHg |
ضریب شکست | 1.448 |
نقطه اشتعال | 61.4°C |
فشار بخار | 0.849mmHg at 25°C |
کدهای خطر | R36/38##Irritating to eyes and skin.:; |
توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |